C22H20F3N3O5 — CID 90710096
[(4R,5R,7R)-2-[4-cyano-3-(trifluoromethyl)phenyl]-1,3-dihydroxy-4,7-dimethyl-5,6-dihydro-4,7-epoxyisoindol-5-yl] N-prop-2-enylcarbamate (PubChem CID 90710096) has the molecular formula C22H20F3N3O5 and a molecular weight of 463.41 g/mol. Its IUPAC name is [(4R,5R,7R)-2-[4-cyano-3-(trifluoromethyl)phenyl]-1,3-dihydroxy-4,7-dimethyl-5,6-dihydro-4,7-epoxyisoindol-5-yl] N-prop-2-enylcarbamate.
| Compound Name | [(4R,5R,7R)-2-[4-cyano-3-(trifluoromethyl)phenyl]-1,3-dihydroxy-4,7-dimethyl-5,6-dihydro-4,7-epoxyisoindol-5-yl] N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 90710096 |
| Molecular Formula | C22H20F3N3O5 |
| Molecular Weight | 463.41 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | [(4R,5R,7R)-2-[4-cyano-3-(trifluoromethyl)phenyl]-1,3-dihydroxy-4,7-dimethyl-5,6-dihydro-4,7-epoxyisoindol-5-yl] N-prop-2-enylcarbamate |
| SMILES | C=CCNC(=O)O[C@@H]1C[C@@]2(C)O[C@]1(C)c1c2c(O)n(-c2ccc(C#N)c(C(F)(F)F)c2)c1O |
| InChI | InChI=1S/C22H20F3N3O5/c1-4-7-27-19(31)32-14-9-20(2)15-16(21(14,3)33-20)18(30)28(17(15)29)12-6-5-11(10-26)13(8-12)22(23,24)25/h4-6,8,14,29-30H,1,7,9H2,2-3H3,(H,27,31)/t14-,20-,21+/m1/s1 |
| InChIKey | FVYHQSFSESTPOK-IFZYUDKTSA-N |
| XLogP | 3.92 |
| TPSA | 116.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|