C7H7ClF4N2 — CID 90710152
3-(1-chloro-1,2,2,2-tetrafluoroethyl)-1,4-dimethylpyrazole (PubChem CID 90710152) has the molecular formula C7H7ClF4N2 and a molecular weight of 230.59 g/mol. Its IUPAC name is 3-(1-chloro-1,2,2,2-tetrafluoroethyl)-1,4-dimethylpyrazole.
| Compound Name | 3-(1-chloro-1,2,2,2-tetrafluoroethyl)-1,4-dimethylpyrazole |
|---|---|
| PubChem CID | 90710152 |
| Molecular Formula | C7H7ClF4N2 |
| Molecular Weight | 230.59 g/mol |
| Exact Mass | 230.02 |
| IUPAC Name | 3-(1-chloro-1,2,2,2-tetrafluoroethyl)-1,4-dimethylpyrazole |
| SMILES | Cc1cn(C)nc1C(F)(Cl)C(F)(F)F |
| InChI | InChI=1S/C7H7ClF4N2/c1-4-3-14(2)13-5(4)6(8,9)7(10,11)12/h3H,1-2H3 |
| InChIKey | ITPYQEGPVDMBLE-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.59 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|