About 5,10-dihydrobenzo[b][1,6]naphthyridine;ethane
5,10-dihydrobenzo[b][1,6]naphthyridine;ethane (PubChem CID 90710187) has the molecular formula C14H16N2
and a molecular weight of 212.30 g/mol. Its IUPAC name is 5,10-dihydrobenzo[b][1,6]naphthyridine;ethane.
Molecular Properties
| Compound Name | 5,10-dihydrobenzo[b][1,6]naphthyridine;ethane |
| PubChem CID | 90710187 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 5,10-dihydrobenzo[b][1,6]naphthyridine;ethane |
| SMILES | CC.c1ccc2c(c1)Cc1cnccc1N2 |
| InChI | InChI=1S/C12H10N2.C2H6/c1-2-4-11-9(3-1)7-10-8-13-6-5-12(10)14-11;1-2/h1-6,8,14H,7H2;1-2H3 |
| InChIKey | JVJJMYYHTSTIFK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,10-dihydrobenzo[b][1,6]naphthyridine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,10-dihydrobenzo[b][1,6]naphthyridine;ethane?
The IUPAC name of 5,10-dihydrobenzo[b][1,6]naphthyridine;ethane (CID 90710187) is 5,10-dihydrobenzo[b][1,6]naphthyridine;ethane.
What is the SMILES notation for 5,10-dihydrobenzo[b][1,6]naphthyridine;ethane?
The canonical SMILES for 5,10-dihydrobenzo[b][1,6]naphthyridine;ethane is CC.c1ccc2c(c1)Cc1cnccc1N2.
What is the InChIKey of 5,10-dihydrobenzo[b][1,6]naphthyridine;ethane?
The InChIKey is JVJJMYYHTSTIFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2.C2H6/c1-2-4-11-9(3-1)7-10-8-13-6-5-12(10)14-11;1-2/h1-6,8,14H,7H2;1-2H3.
What are the key properties of 5,10-dihydrobenzo[b][1,6]naphthyridine;ethane?
5,10-dihydrobenzo[b][1,6]naphthyridine;ethane has a molecular weight of 212.30 g/mol, XLogP of 3.76, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,10-dihydrobenzo[b][1,6]naphthyridine;ethane is sourced from PubChem (CID 90710187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).