C18H13F6NO3 — CID 90710239
5-methoxy-2-[[4-(trifluoromethoxy)phenyl]methyl]-7-(trifluoromethyl)isoindol-1-ol (PubChem CID 90710239) has the molecular formula C18H13F6NO3 and a molecular weight of 405.29 g/mol. Its IUPAC name is 5-methoxy-2-[[4-(trifluoromethoxy)phenyl]methyl]-7-(trifluoromethyl)isoindol-1-ol.
| Compound Name | 5-methoxy-2-[[4-(trifluoromethoxy)phenyl]methyl]-7-(trifluoromethyl)isoindol-1-ol |
|---|---|
| PubChem CID | 90710239 |
| Molecular Formula | C18H13F6NO3 |
| Molecular Weight | 405.29 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | 5-methoxy-2-[[4-(trifluoromethoxy)phenyl]methyl]-7-(trifluoromethyl)isoindol-1-ol |
| SMILES | COc1cc(C(F)(F)F)c2c(O)n(Cc3ccc(OC(F)(F)F)cc3)cc2c1 |
| InChI | InChI=1S/C18H13F6NO3/c1-27-13-6-11-9-25(16(26)15(11)14(7-13)17(19,20)21)8-10-2-4-12(5-3-10)28-18(22,23)24/h2-7,9,26H,8H2,1H3 |
| InChIKey | SGFPPVPGDJGTEH-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 43.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.29 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |