C22H23ClNO+ — CID 90710322
(5S,6S)-2-chloro-3,3-dimethyl-5-naphthalen-2-yl-6-phenyl-1,3-oxazinan-3-ium (PubChem CID 90710322) has the molecular formula C22H23ClNO+ and a molecular weight of 352.89 g/mol. Its IUPAC name is (5S,6S)-2-chloro-3,3-dimethyl-5-naphthalen-2-yl-6-phenyl-1,3-oxazinan-3-ium.
| Compound Name | (5S,6S)-2-chloro-3,3-dimethyl-5-naphthalen-2-yl-6-phenyl-1,3-oxazinan-3-ium |
|---|---|
| PubChem CID | 90710322 |
| Molecular Formula | C22H23ClNO+ |
| Molecular Weight | 352.89 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | (5S,6S)-2-chloro-3,3-dimethyl-5-naphthalen-2-yl-6-phenyl-1,3-oxazinan-3-ium |
| SMILES | C[N+]1(C)C[C@H](c2ccc3ccccc3c2)[C@@H](c2ccccc2)OC1Cl |
| InChI | InChI=1S/C22H23ClNO/c1-24(2)15-20(19-13-12-16-8-6-7-11-18(16)14-19)21(25-22(24)23)17-9-4-3-5-10-17/h3-14,20-22H,15H2,1-2H3/q+1/t20-,21-,22?/m1/s1 |
| InChIKey | AKWPRWCHXUSMKP-JAZPPYFYSA-N |
| XLogP | 5.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.89 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|