About 5-[(5-imino-2,6-dioxopyrimidin-4-yl)-methylamino]pentanenitrile
5-[(5-imino-2,6-dioxopyrimidin-4-yl)-methylamino]pentanenitrile (PubChem CID 90710573) has the molecular formula C10H13N5O2
and a molecular weight of 235.25 g/mol. Its IUPAC name is 5-[(5-imino-2,6-dioxopyrimidin-4-yl)-methylamino]pentanenitrile.
Molecular Properties
| Compound Name | 5-[(5-imino-2,6-dioxopyrimidin-4-yl)-methylamino]pentanenitrile |
| PubChem CID | 90710573 |
| Molecular Formula | C10H13N5O2 |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 5-[(5-imino-2,6-dioxopyrimidin-4-yl)-methylamino]pentanenitrile |
| SMILES | [H]/N=C1\C(=O)NC(=O)N=C1N(C)CCCCC#N |
| InChI | InChI=1S/C10H13N5O2/c1-15(6-4-2-3-5-11)8-7(12)9(16)14-10(17)13-8/h12H,2-4,6H2,1H3,(H,14,16,17)/b12-7- |
| InChIKey | VOMSILIVCLAEFJ-GHXNOFRVSA-N |
| XLogP | 0.28 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-[(5-imino-2,6-dioxopyrimidin-4-yl)-methylamino]pentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(5-imino-2,6-dioxopyrimidin-4-yl)-methylamino]pentanenitrile?
The IUPAC name of 5-[(5-imino-2,6-dioxopyrimidin-4-yl)-methylamino]pentanenitrile (CID 90710573) is 5-[(5-imino-2,6-dioxopyrimidin-4-yl)-methylamino]pentanenitrile.
What is the SMILES notation for 5-[(5-imino-2,6-dioxopyrimidin-4-yl)-methylamino]pentanenitrile?
The canonical SMILES for 5-[(5-imino-2,6-dioxopyrimidin-4-yl)-methylamino]pentanenitrile is [H]/N=C1\C(=O)NC(=O)N=C1N(C)CCCCC#N.
What is the InChIKey of 5-[(5-imino-2,6-dioxopyrimidin-4-yl)-methylamino]pentanenitrile?
The InChIKey is VOMSILIVCLAEFJ-GHXNOFRVSA-N. The full InChI is InChI=1S/C10H13N5O2/c1-15(6-4-2-3-5-11)8-7(12)9(16)14-10(17)13-8/h12H,2-4,6H2,1H3,(H,14,16,17)/b12-7-.
What are the key properties of 5-[(5-imino-2,6-dioxopyrimidin-4-yl)-methylamino]pentanenitrile?
5-[(5-imino-2,6-dioxopyrimidin-4-yl)-methylamino]pentanenitrile has a molecular weight of 235.25 g/mol, XLogP of 0.28, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(5-imino-2,6-dioxopyrimidin-4-yl)-methylamino]pentanenitrile is sourced from PubChem (CID 90710573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).