About hydroxy-methyl-oxophosphanium;nitroxyl
hydroxy-methyl-oxophosphanium;nitroxyl (PubChem CID 90711429) has the molecular formula CH5NO3P+
and a molecular weight of 110.03 g/mol. Its IUPAC name is hydroxy-methyl-oxophosphanium;nitroxyl.
Molecular Properties
| Compound Name | hydroxy-methyl-oxophosphanium;nitroxyl |
| PubChem CID | 90711429 |
| Molecular Formula | CH5NO3P+ |
| Molecular Weight | 110.03 g/mol |
| Exact Mass | 110.00 |
| IUPAC Name | hydroxy-methyl-oxophosphanium;nitroxyl |
| SMILES | C[P+](=O)O.N=O |
| InChI | InChI=1S/CH3O2P.HNO/c1-4(2)3;1-2/h1H3;1H/p+1 |
| InChIKey | TUUBBQGZZYVQAC-UHFFFAOYSA-O |
| XLogP | 0.68 |
| TPSA | 78.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.03 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze hydroxy-methyl-oxophosphanium;nitroxyl with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxy-methyl-oxophosphanium;nitroxyl?
The IUPAC name of hydroxy-methyl-oxophosphanium;nitroxyl (CID 90711429) is hydroxy-methyl-oxophosphanium;nitroxyl.
What is the SMILES notation for hydroxy-methyl-oxophosphanium;nitroxyl?
The canonical SMILES for hydroxy-methyl-oxophosphanium;nitroxyl is C[P+](=O)O.N=O.
What is the InChIKey of hydroxy-methyl-oxophosphanium;nitroxyl?
The InChIKey is TUUBBQGZZYVQAC-UHFFFAOYSA-O. The full InChI is InChI=1S/CH3O2P.HNO/c1-4(2)3;1-2/h1H3;1H/p+1.
What are the key properties of hydroxy-methyl-oxophosphanium;nitroxyl?
hydroxy-methyl-oxophosphanium;nitroxyl has a molecular weight of 110.03 g/mol, XLogP of 0.68, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxy-methyl-oxophosphanium;nitroxyl is sourced from PubChem (CID 90711429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).