C15H16N2O5 — CID 90711464
(1S,2R,4R,5S,6R)-2-amino-4-benzamidobicyclo[3.1.0]hexane-2,6-dicarboxylic acid (PubChem CID 90711464) has the molecular formula C15H16N2O5 and a molecular weight of 304.30 g/mol. Its IUPAC name is (1S,2R,4R,5S,6R)-2-amino-4-benzamidobicyclo[3.1.0]hexane-2,6-dicarboxylic acid.
| Compound Name | (1S,2R,4R,5S,6R)-2-amino-4-benzamidobicyclo[3.1.0]hexane-2,6-dicarboxylic acid |
|---|---|
| PubChem CID | 90711464 |
| Molecular Formula | C15H16N2O5 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | (1S,2R,4R,5S,6R)-2-amino-4-benzamidobicyclo[3.1.0]hexane-2,6-dicarboxylic acid |
| SMILES | N[C@]1(C(=O)O)C[C@@H](NC(=O)c2ccccc2)[C@@H]2[C@@H](C(=O)O)[C@H]21 |
| InChI | InChI=1S/C15H16N2O5/c16-15(14(21)22)6-8(9-10(11(9)15)13(19)20)17-12(18)7-4-2-1-3-5-7/h1-5,8-11H,6,16H2,(H,17,18)(H,19,20)(H,21,22)/t8-,9-,10-,11+,15-/m1/s1 |
| InChIKey | ZDVZEEBBIZFFGQ-JAPZVGMSSA-N |
| XLogP | -0.08 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |