C8H14N2 — CID 90711601
1,2,3,5,6,7,8,8a-octahydro-1,7-naphthyridine (PubChem CID 90711601) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is 1,2,3,5,6,7,8,8a-octahydro-1,7-naphthyridine.
| Compound Name | 1,2,3,5,6,7,8,8a-octahydro-1,7-naphthyridine |
|---|---|
| PubChem CID | 90711601 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 1,2,3,5,6,7,8,8a-octahydro-1,7-naphthyridine |
| SMILES | C1=C2CCNCC2NCC1 |
| InChI | InChI=1S/C8H14N2/c1-2-7-3-5-9-6-8(7)10-4-1/h2,8-10H,1,3-6H2 |
| InChIKey | FIGZODGCIHWRBZ-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|