C27H33N3O3 — CID 90711706
7-(dimethylamino)-2-hexa-2,4-dienoyl-N-(4-hydroxy-2,3,5-trimethylphenyl)-3,4-dihydro-1H-isoquinoline-1-carboxamide (PubChem CID 90711706) has the molecular formula C27H33N3O3 and a molecular weight of 447.58 g/mol. Its IUPAC name is 7-(dimethylamino)-2-hexa-2,4-dienoyl-N-(4-hydroxy-2,3,5-trimethylphenyl)-3,4-dihydro-1H-isoquinoline-1-carboxamide.
| Compound Name | 7-(dimethylamino)-2-hexa-2,4-dienoyl-N-(4-hydroxy-2,3,5-trimethylphenyl)-3,4-dihydro-1H-isoquinoline-1-carboxamide |
|---|---|
| PubChem CID | 90711706 |
| Molecular Formula | C27H33N3O3 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | 7-(dimethylamino)-2-hexa-2,4-dienoyl-N-(4-hydroxy-2,3,5-trimethylphenyl)-3,4-dihydro-1H-isoquinoline-1-carboxamide |
| SMILES | CC=CC=CC(=O)N1CCc2ccc(N(C)C)cc2C1C(=O)Nc1cc(C)c(O)c(C)c1C |
| InChI | InChI=1S/C27H33N3O3/c1-7-8-9-10-24(31)30-14-13-20-11-12-21(29(5)6)16-22(20)25(30)27(33)28-23-15-17(2)26(32)19(4)18(23)3/h7-12,15-16,25,32H,13-14H2,1-6H3,(H,28,33) |
| InChIKey | XAEBWHPQSAWQLT-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|