C11H10O3 — CID 90712426
1-oxacyclododeca-4,6,8,10-tetraene-2,3-dione (PubChem CID 90712426) has the molecular formula C11H10O3 and a molecular weight of 190.20 g/mol. Its IUPAC name is 1-oxacyclododeca-4,6,8,10-tetraene-2,3-dione.
| Compound Name | 1-oxacyclododeca-4,6,8,10-tetraene-2,3-dione |
|---|---|
| PubChem CID | 90712426 |
| Molecular Formula | C11H10O3 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 1-oxacyclododeca-4,6,8,10-tetraene-2,3-dione |
| SMILES | O=C1C=CC=CC=CC=CCOC1=O |
| InChI | InChI=1S/C11H10O3/c12-10-8-6-4-2-1-3-5-7-9-14-11(10)13/h1-8H,9H2 |
| InChIKey | HAYIQTJYYDZBDQ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|