C20H22N2O5 — CID 90712513
3-(3-oxo-1H-isoindol-2-yl)-3-(3,4,5-trimethoxyphenyl)propanamide (PubChem CID 90712513) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is 3-(3-oxo-1H-isoindol-2-yl)-3-(3,4,5-trimethoxyphenyl)propanamide.
| Compound Name | 3-(3-oxo-1H-isoindol-2-yl)-3-(3,4,5-trimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 90712513 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 3-(3-oxo-1H-isoindol-2-yl)-3-(3,4,5-trimethoxyphenyl)propanamide |
| SMILES | COc1cc(C(CC(N)=O)N2Cc3ccccc3C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C20H22N2O5/c1-25-16-8-13(9-17(26-2)19(16)27-3)15(10-18(21)23)22-11-12-6-4-5-7-14(12)20(22)24/h4-9,15H,10-11H2,1-3H3,(H2,21,23) |
| InChIKey | SSFZPYVUUUTISA-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 91.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |