C22H26N4O8S — CID 90712649
2-(2-amino-1,3-thiazol-4-yl)-2,2-dihydroxy-N-[2,3,5,6-tetrahydroxy-4-[2-[(2-methoxy-2-phenylethyl)amino]ethyl]phenyl]acetamide (PubChem CID 90712649) has the molecular formula C22H26N4O8S and a molecular weight of 506.54 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-2,2-dihydroxy-N-[2,3,5,6-tetrahydroxy-4-[2-[(2-methoxy-2-phenylethyl)amino]ethyl]phenyl]acetamide.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-2,2-dihydroxy-N-[2,3,5,6-tetrahydroxy-4-[2-[(2-methoxy-2-phenylethyl)amino]ethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 90712649 |
| Molecular Formula | C22H26N4O8S |
| Molecular Weight | 506.54 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-2,2-dihydroxy-N-[2,3,5,6-tetrahydroxy-4-[2-[(2-methoxy-2-phenylethyl)amino]ethyl]phenyl]acetamide |
| SMILES | COC(CNCCc1c(O)c(O)c(NC(=O)C(O)(O)c2csc(N)n2)c(O)c1O)c1ccccc1 |
| InChI | InChI=1S/C22H26N4O8S/c1-34-13(11-5-3-2-4-6-11)9-24-8-7-12-16(27)18(29)15(19(30)17(12)28)26-20(31)22(32,33)14-10-35-21(23)25-14/h2-6,10,13,24,27-30,32-33H,7-9H2,1H3,(H2,23,25)(H,26,31) |
| InChIKey | NDXSXYOSDIJHFD-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 210.65 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.54 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|