C18H20N2O5S — CID 9071303
2-ethoxy-N-[2-(3-methylsulfonylanilino)-2-oxoethyl]benzamide (PubChem CID 9071303) has the molecular formula C18H20N2O5S and a molecular weight of 376.43 g/mol. Its IUPAC name is 2-ethoxy-N-[2-(3-methylsulfonylanilino)-2-oxoethyl]benzamide.
| Compound Name | 2-ethoxy-N-[2-(3-methylsulfonylanilino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 9071303 |
| Molecular Formula | C18H20N2O5S |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 2-ethoxy-N-[2-(3-methylsulfonylanilino)-2-oxoethyl]benzamide |
| SMILES | CCOc1ccccc1C(=O)NCC(=O)Nc1cccc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C18H20N2O5S/c1-3-25-16-10-5-4-9-15(16)18(22)19-12-17(21)20-13-7-6-8-14(11-13)26(2,23)24/h4-11H,3,12H2,1-2H3,(H,19,22)(H,20,21) |
| InChIKey | PSGSJFVTJNZBGK-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |