About N-isoquinolin-6-yl-1,3,4-thiadiazol-2-amine
N-isoquinolin-6-yl-1,3,4-thiadiazol-2-amine (PubChem CID 90713193) has the molecular formula C11H8N4S
and a molecular weight of 228.28 g/mol. Its IUPAC name is N-isoquinolin-6-yl-1,3,4-thiadiazol-2-amine.
Molecular Properties
| Compound Name | N-isoquinolin-6-yl-1,3,4-thiadiazol-2-amine |
| PubChem CID | 90713193 |
| Molecular Formula | C11H8N4S |
| Molecular Weight | 228.28 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | N-isoquinolin-6-yl-1,3,4-thiadiazol-2-amine |
| SMILES | c1cc2cc(Nc3nncs3)ccc2cn1 |
| InChI | InChI=1S/C11H8N4S/c1-2-10(14-11-15-13-7-16-11)5-8-3-4-12-6-9(1)8/h1-7H,(H,14,15) |
| InChIKey | CRLUYJNLSLIAEA-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.28 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-isoquinolin-6-yl-1,3,4-thiadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-isoquinolin-6-yl-1,3,4-thiadiazol-2-amine?
The IUPAC name of N-isoquinolin-6-yl-1,3,4-thiadiazol-2-amine (CID 90713193) is N-isoquinolin-6-yl-1,3,4-thiadiazol-2-amine.
What is the SMILES notation for N-isoquinolin-6-yl-1,3,4-thiadiazol-2-amine?
The canonical SMILES for N-isoquinolin-6-yl-1,3,4-thiadiazol-2-amine is c1cc2cc(Nc3nncs3)ccc2cn1.
What is the InChIKey of N-isoquinolin-6-yl-1,3,4-thiadiazol-2-amine?
The InChIKey is CRLUYJNLSLIAEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N4S/c1-2-10(14-11-15-13-7-16-11)5-8-3-4-12-6-9(1)8/h1-7H,(H,14,15).
What are the key properties of N-isoquinolin-6-yl-1,3,4-thiadiazol-2-amine?
N-isoquinolin-6-yl-1,3,4-thiadiazol-2-amine has a molecular weight of 228.28 g/mol, XLogP of 2.83, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-isoquinolin-6-yl-1,3,4-thiadiazol-2-amine is sourced from PubChem (CID 90713193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).