C48H60N12+4 — CID 90713413
5,10,15,20-tetrakis(1,3-diethylimidazol-2-ylium-2-yl)-21,22,23,24-tetrahydroporphyrin (PubChem CID 90713413) has the molecular formula C48H60N12+4 and a molecular weight of 805.09 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(1,3-diethylimidazol-2-ylium-2-yl)-21,22,23,24-tetrahydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis(1,3-diethylimidazol-2-ylium-2-yl)-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 90713413 |
| Molecular Formula | C48H60N12+4 |
| Molecular Weight | 805.09 g/mol |
| Exact Mass | 804.50 |
| IUPAC Name | 5,10,15,20-tetrakis(1,3-diethylimidazol-2-ylium-2-yl)-21,22,23,24-tetrahydroporphyrin |
| SMILES | CCn1ccn(CC)[c+]1C1=c2ccc([nH]2)=C([c+]2n(CC)ccn2CC)c2ccc([nH]2)C([c+]2n(CC)ccn2CC)=c2ccc([nH]2)=C([c+]2n(CC)ccn2CC)c2ccc1[nH]2 |
| InChI | InChI=1S/C48H60N12/c1-9-53-25-26-54(10-2)45(53)41-33-17-19-35(49-33)42(46-55(11-3)27-28-56(46)12-4)37-21-23-39(51-37)44(48-59(15-7)31-32-60(48)16-8)40-24-22-38(52-40)43(36-20-18-34(41)50-36)47-57(13-5)29-30-58(47)14-6/h17-32,49-52H,9-16H2,1-8H3/q+4 |
| InChIKey | RMPRRUAPLVEVCS-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 102.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.09 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|