C24H28BrN6O2+ — CID 90713416
(7-amino-6-bromo-3-quinolin-3-ylpyrazolo[1,5-a]pyrimidin-5-yl)methyl-(3-methoxyoxan-4-yl)-dimethylazanium (PubChem CID 90713416) has the molecular formula C24H28BrN6O2+ and a molecular weight of 512.43 g/mol. Its IUPAC name is (7-amino-6-bromo-3-quinolin-3-ylpyrazolo[1,5-a]pyrimidin-5-yl)methyl-(3-methoxyoxan-4-yl)-dimethylazanium.
| Compound Name | (7-amino-6-bromo-3-quinolin-3-ylpyrazolo[1,5-a]pyrimidin-5-yl)methyl-(3-methoxyoxan-4-yl)-dimethylazanium |
|---|---|
| PubChem CID | 90713416 |
| Molecular Formula | C24H28BrN6O2+ |
| Molecular Weight | 512.43 g/mol |
| Exact Mass | 511.15 |
| IUPAC Name | (7-amino-6-bromo-3-quinolin-3-ylpyrazolo[1,5-a]pyrimidin-5-yl)methyl-(3-methoxyoxan-4-yl)-dimethylazanium |
| SMILES | COC1COCCC1[N+](C)(C)Cc1nc2c(-c3cnc4ccccc4c3)cnn2c(N)c1Br |
| InChI | InChI=1S/C24H28BrN6O2/c1-31(2,20-8-9-33-14-21(20)32-3)13-19-22(25)23(26)30-24(29-19)17(12-28-30)16-10-15-6-4-5-7-18(15)27-11-16/h4-7,10-12,20-21H,8-9,13-14,26H2,1-3H3/q+1 |
| InChIKey | RBFASQAAMAVLFB-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|