C16H13FN2O4S — CID 90713600
5-[(6-fluoro-4H-1,3-benzodioxin-8-yl)methylidene]-1-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 90713600) has the molecular formula C16H13FN2O4S and a molecular weight of 348.36 g/mol. Its IUPAC name is 5-[(6-fluoro-4H-1,3-benzodioxin-8-yl)methylidene]-1-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[(6-fluoro-4H-1,3-benzodioxin-8-yl)methylidene]-1-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 90713600 |
| Molecular Formula | C16H13FN2O4S |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | 5-[(6-fluoro-4H-1,3-benzodioxin-8-yl)methylidene]-1-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | C=CCN1C(=O)C(=Cc2cc(F)cc3c2OCOC3)C(=O)NC1=S |
| InChI | InChI=1S/C16H13FN2O4S/c1-2-3-19-15(21)12(14(20)18-16(19)24)6-9-4-11(17)5-10-7-22-8-23-13(9)10/h2,4-6H,1,3,7-8H2,(H,18,20,24) |
| InChIKey | SIWCVJYUOSCAQG-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|