C19H15Cl2FN2O3 — CID 90713739
N-(3,4-dichlorophenyl)-N-[(4-fluorophenyl)methyl]-1-methyl-4,5-dioxopyrrolidine-3-carboxamide (PubChem CID 90713739) has the molecular formula C19H15Cl2FN2O3 and a molecular weight of 409.24 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-N-[(4-fluorophenyl)methyl]-1-methyl-4,5-dioxopyrrolidine-3-carboxamide.
| Compound Name | N-(3,4-dichlorophenyl)-N-[(4-fluorophenyl)methyl]-1-methyl-4,5-dioxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 90713739 |
| Molecular Formula | C19H15Cl2FN2O3 |
| Molecular Weight | 409.24 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | N-(3,4-dichlorophenyl)-N-[(4-fluorophenyl)methyl]-1-methyl-4,5-dioxopyrrolidine-3-carboxamide |
| SMILES | CN1CC(C(=O)N(Cc2ccc(F)cc2)c2ccc(Cl)c(Cl)c2)C(=O)C1=O |
| InChI | InChI=1S/C19H15Cl2FN2O3/c1-23-10-14(17(25)19(23)27)18(26)24(9-11-2-4-12(22)5-3-11)13-6-7-15(20)16(21)8-13/h2-8,14H,9-10H2,1H3 |
| InChIKey | YCRZQIMORXVEIN-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.24 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|