C6H11NO4S — CID 90713777
(3S)-3-(1-methoxyethyl)-4-oxoazetidine-2-sulfinic acid (PubChem CID 90713777) has the molecular formula C6H11NO4S and a molecular weight of 193.22 g/mol. Its IUPAC name is (3S)-3-(1-methoxyethyl)-4-oxoazetidine-2-sulfinic acid.
| Compound Name | (3S)-3-(1-methoxyethyl)-4-oxoazetidine-2-sulfinic acid |
|---|---|
| PubChem CID | 90713777 |
| Molecular Formula | C6H11NO4S |
| Molecular Weight | 193.22 g/mol |
| Exact Mass | 193.04 |
| IUPAC Name | (3S)-3-(1-methoxyethyl)-4-oxoazetidine-2-sulfinic acid |
| SMILES | COC(C)[C@H]1C(=O)NC1S(=O)O |
| InChI | InChI=1S/C6H11NO4S/c1-3(11-2)4-5(8)7-6(4)12(9)10/h3-4,6H,1-2H3,(H,7,8)(H,9,10)/t3?,4-,6?/m0/s1 |
| InChIKey | XLCNTQGWMHUHJN-ZSGNRXJESA-N |
| XLogP | -0.68 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.22 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|