C28H38O4S2 — CID 90713902
3-[2-tert-butyl-4-(hydroxymethyl)-6-methylphenyl]sulfanyl-6-pentyl-6-(2-thiophen-2-ylethyl)oxane-2,4-dione (PubChem CID 90713902) has the molecular formula C28H38O4S2 and a molecular weight of 502.74 g/mol. Its IUPAC name is 3-[2-tert-butyl-4-(hydroxymethyl)-6-methylphenyl]sulfanyl-6-pentyl-6-(2-thiophen-2-ylethyl)oxane-2,4-dione.
| Compound Name | 3-[2-tert-butyl-4-(hydroxymethyl)-6-methylphenyl]sulfanyl-6-pentyl-6-(2-thiophen-2-ylethyl)oxane-2,4-dione |
|---|---|
| PubChem CID | 90713902 |
| Molecular Formula | C28H38O4S2 |
| Molecular Weight | 502.74 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | 3-[2-tert-butyl-4-(hydroxymethyl)-6-methylphenyl]sulfanyl-6-pentyl-6-(2-thiophen-2-ylethyl)oxane-2,4-dione |
| SMILES | CCCCCC1(CCc2cccs2)CC(=O)C(Sc2c(C)cc(CO)cc2C(C)(C)C)C(=O)O1 |
| InChI | InChI=1S/C28H38O4S2/c1-6-7-8-12-28(13-11-21-10-9-14-33-21)17-23(30)25(26(31)32-28)34-24-19(2)15-20(18-29)16-22(24)27(3,4)5/h9-10,14-16,25,29H,6-8,11-13,17-18H2,1-5H3 |
| InChIKey | DLTIGSZWLVINNW-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.74 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|