About tris[2,4,6-tri(propan-2-yl)phenyl]phosphane
tris[2,4,6-tri(propan-2-yl)phenyl]phosphane (PubChem CID 90713930) has the molecular formula C45H69P
and a molecular weight of 641.02 g/mol. Its IUPAC name is tris[2,4,6-tri(propan-2-yl)phenyl]phosphane.
Molecular Properties
| Compound Name | tris[2,4,6-tri(propan-2-yl)phenyl]phosphane |
| PubChem CID | 90713930 |
| Molecular Formula | C45H69P |
| Molecular Weight | 641.02 g/mol |
| Exact Mass | 640.51 |
| IUPAC Name | tris[2,4,6-tri(propan-2-yl)phenyl]phosphane |
| SMILES | CC(C)c1cc(C(C)C)c(P(c2c(C(C)C)cc(C(C)C)cc2C(C)C)c2c(C(C)C)cc(C(C)C)cc2C(C)C)c(C(C)C)c1 |
| InChI | InChI=1S/C45H69P/c1-25(2)34-19-37(28(7)8)43(38(20-34)29(9)10)46(44-39(30(11)12)21-35(26(3)4)22-40(44)31(13)14)45-41(32(15)16)23-36(27(5)6)24-42(45)33(17)18/h19-33H,1-18H3 |
| InChIKey | IYYKKHFUQOTVSD-UHFFFAOYSA-N |
| XLogP | 13.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 641.02 |
| LogP ≤ 5 | 13.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tris[2,4,6-tri(propan-2-yl)phenyl]phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris[2,4,6-tri(propan-2-yl)phenyl]phosphane?
The IUPAC name of tris[2,4,6-tri(propan-2-yl)phenyl]phosphane (CID 90713930) is tris[2,4,6-tri(propan-2-yl)phenyl]phosphane.
What is the SMILES notation for tris[2,4,6-tri(propan-2-yl)phenyl]phosphane?
The canonical SMILES for tris[2,4,6-tri(propan-2-yl)phenyl]phosphane is CC(C)c1cc(C(C)C)c(P(c2c(C(C)C)cc(C(C)C)cc2C(C)C)c2c(C(C)C)cc(C(C)C)cc2C(C)C)c(C(C)C)c1.
What is the InChIKey of tris[2,4,6-tri(propan-2-yl)phenyl]phosphane?
The InChIKey is IYYKKHFUQOTVSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C45H69P/c1-25(2)34-19-37(28(7)8)43(38(20-34)29(9)10)46(44-39(30(11)12)21-35(26(3)4)22-40(44)31(13)14)45-41(32(15)16)23-36(27(5)6)24-42(45)33(17)18/h19-33H,1-18H3.
What are the key properties of tris[2,4,6-tri(propan-2-yl)phenyl]phosphane?
tris[2,4,6-tri(propan-2-yl)phenyl]phosphane has a molecular weight of 641.02 g/mol, XLogP of 13.56, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tris[2,4,6-tri(propan-2-yl)phenyl]phosphane is sourced from PubChem (CID 90713930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).