About CID 90714549
CID 90714549 (PubChem CID 90714549) has the molecular formula C45H39B8BrFN7O9
and a molecular weight of 1007.25 g/mol.
Molecular Properties
| Compound Name | CID 90714549 |
| PubChem CID | 90714549 |
| Molecular Formula | C45H39B8BrFN7O9 |
| Molecular Weight | 1007.25 g/mol |
| Exact Mass | 1007.27 |
| IUPAC Name | — |
| SMILES | COc1ccc2c(c1)C(=O)N(C[C@@]1(c3ccc(Br)cc3)NC(=O)N(C)C1=O)C2.COc1ccc2c(c1)C(=O)N(C[C@@]1(c3ccc(Oc4ccc(F)cn4)cc3)NC(=O)N(C)C1=O)C2.[B]B([B])B([B])B([B])[B] |
| InChI | InChI=1S/C25H21FN4O5.C20H18BrN3O4.B8/c1-29-23(32)25(28-24(29)33,14-30-13-15-3-7-19(34-2)11-20(15)22(30)31)16-4-8-18(9-5-16)35-21-10-6-17(26)12-27-21;1-23-18(26)20(22-19(23)27,13-4-6-14(21)7-5-13)11-24-10-12-3-8-15(28-2)9-16(12)17(24)25;1-6(2)8(5)7(3)4/h3-12H,13-14H2,1-2H3,(H,28,33);3-9H,10-11H2,1-2H3,(H,22,27);/t25-;20-;/m00./s1 |
| InChIKey | KCXWLPJEXSFKET-AEDASDHPSA-N |
| XLogP | 2.50 |
| TPSA | 180.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 71 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 1007.25 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze CID 90714549 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 90714549?
The IUPAC name of CID 90714549 (CID 90714549) is not available.
What is the SMILES notation for CID 90714549?
The canonical SMILES for CID 90714549 is COc1ccc2c(c1)C(=O)N(C[C@@]1(c3ccc(Br)cc3)NC(=O)N(C)C1=O)C2.COc1ccc2c(c1)C(=O)N(C[C@@]1(c3ccc(Oc4ccc(F)cn4)cc3)NC(=O)N(C)C1=O)C2.[B]B([B])B([B])B([B])[B].
What is the InChIKey of CID 90714549?
The InChIKey is KCXWLPJEXSFKET-AEDASDHPSA-N. The full InChI is InChI=1S/C25H21FN4O5.C20H18BrN3O4.B8/c1-29-23(32)25(28-24(29)33,14-30-13-15-3-7-19(34-2)11-20(15)22(30)31)16-4-8-18(9-5-16)35-21-10-6-17(26)12-27-21;1-23-18(26)20(22-19(23)27,13-4-6-14(21)7-5-13)11-24-10-12-3-8-15(28-2)9-16(12)17(24)25;1-6(2)8(5)7(3)4/h3-12H,13-14H2,1-2H3,(H,28,33);3-9H,10-11H2,1-2H3,(H,22,27);/t25-;20-;/m00./s1.
What are the key properties of CID 90714549?
CID 90714549 has a molecular weight of 1007.25 g/mol, XLogP of 2.50, 12 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 90714549 is sourced from PubChem (CID 90714549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).