C16H21F2N — CID 90714676
4-[1-(4-ethenylcyclohexyl)ethyl]-2,3-difluoroaniline (PubChem CID 90714676) has the molecular formula C16H21F2N and a molecular weight of 265.35 g/mol. Its IUPAC name is 4-[1-(4-ethenylcyclohexyl)ethyl]-2,3-difluoroaniline.
| Compound Name | 4-[1-(4-ethenylcyclohexyl)ethyl]-2,3-difluoroaniline |
|---|---|
| PubChem CID | 90714676 |
| Molecular Formula | C16H21F2N |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 4-[1-(4-ethenylcyclohexyl)ethyl]-2,3-difluoroaniline |
| SMILES | C=CC1CCC(C(C)c2ccc(N)c(F)c2F)CC1 |
| InChI | InChI=1S/C16H21F2N/c1-3-11-4-6-12(7-5-11)10(2)13-8-9-14(19)16(18)15(13)17/h3,8-12H,1,4-7,19H2,2H3 |
| InChIKey | QEDXFKPRGWSZSM-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|