About 4-[1-(4-ethenylcyclohexyl)ethyl]-2,3-difluoroaniline
4-[1-(4-ethenylcyclohexyl)ethyl]-2,3-difluoroaniline (PubChem CID 90714676) has the molecular formula C16H21F2N
and a molecular weight of 265.35 g/mol. Its IUPAC name is 4-[1-(4-ethenylcyclohexyl)ethyl]-2,3-difluoroaniline.
Molecular Properties
| Compound Name | 4-[1-(4-ethenylcyclohexyl)ethyl]-2,3-difluoroaniline |
| PubChem CID | 90714676 |
| Molecular Formula | C16H21F2N |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 4-[1-(4-ethenylcyclohexyl)ethyl]-2,3-difluoroaniline |
| SMILES | C=CC1CCC(C(C)c2ccc(N)c(F)c2F)CC1 |
| InChI | InChI=1S/C16H21F2N/c1-3-11-4-6-12(7-5-11)10(2)13-8-9-14(19)16(18)15(13)17/h3,8-12H,1,4-7,19H2,2H3 |
| InChIKey | QEDXFKPRGWSZSM-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[1-(4-ethenylcyclohexyl)ethyl]-2,3-difluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(4-ethenylcyclohexyl)ethyl]-2,3-difluoroaniline?
The IUPAC name of 4-[1-(4-ethenylcyclohexyl)ethyl]-2,3-difluoroaniline (CID 90714676) is 4-[1-(4-ethenylcyclohexyl)ethyl]-2,3-difluoroaniline.
What is the SMILES notation for 4-[1-(4-ethenylcyclohexyl)ethyl]-2,3-difluoroaniline?
The canonical SMILES for 4-[1-(4-ethenylcyclohexyl)ethyl]-2,3-difluoroaniline is C=CC1CCC(C(C)c2ccc(N)c(F)c2F)CC1.
What is the InChIKey of 4-[1-(4-ethenylcyclohexyl)ethyl]-2,3-difluoroaniline?
The InChIKey is QEDXFKPRGWSZSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21F2N/c1-3-11-4-6-12(7-5-11)10(2)13-8-9-14(19)16(18)15(13)17/h3,8-12H,1,4-7,19H2,2H3.
What are the key properties of 4-[1-(4-ethenylcyclohexyl)ethyl]-2,3-difluoroaniline?
4-[1-(4-ethenylcyclohexyl)ethyl]-2,3-difluoroaniline has a molecular weight of 265.35 g/mol, XLogP of 4.64, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(4-ethenylcyclohexyl)ethyl]-2,3-difluoroaniline is sourced from PubChem (CID 90714676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).