C31H24F6N2S2 — CID 90714816
4-[2-[4-[2-[2,4-dimethyl-5-(2-pyridin-4-ylethenyl)thiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-3,5-dimethylthiophen-2-yl]ethenyl]pyridine (PubChem CID 90714816) has the molecular formula C31H24F6N2S2 and a molecular weight of 602.67 g/mol. Its IUPAC name is 4-[2-[4-[2-[2,4-dimethyl-5-(2-pyridin-4-ylethenyl)thiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-3,5-dimethylthiophen-2-yl]ethenyl]pyridine.
| Compound Name | 4-[2-[4-[2-[2,4-dimethyl-5-(2-pyridin-4-ylethenyl)thiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-3,5-dimethylthiophen-2-yl]ethenyl]pyridine |
|---|---|
| PubChem CID | 90714816 |
| Molecular Formula | C31H24F6N2S2 |
| Molecular Weight | 602.67 g/mol |
| Exact Mass | 602.13 |
| IUPAC Name | 4-[2-[4-[2-[2,4-dimethyl-5-(2-pyridin-4-ylethenyl)thiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-3,5-dimethylthiophen-2-yl]ethenyl]pyridine |
| SMILES | Cc1sc(C=Cc2ccncc2)c(C)c1C1=C(c2c(C)sc(C=Cc3ccncc3)c2C)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C31H24F6N2S2/c1-17-23(7-5-21-9-13-38-14-10-21)40-19(3)25(17)27-28(30(34,35)31(36,37)29(27,32)33)26-18(2)24(41-20(26)4)8-6-22-11-15-39-16-12-22/h5-16H,1-4H3 |
| InChIKey | JJWLWSWKBFJZAP-UHFFFAOYSA-N |
| XLogP | 10.00 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.67 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|