C25H27ClO4 — CID 90714896
2-[5-(4-chlorophenyl)-2-methylphenyl]-5-[(5-methyl-1,3-dioxan-2-yl)methyl]cyclohexane-1,3-dione (PubChem CID 90714896) has the molecular formula C25H27ClO4 and a molecular weight of 426.94 g/mol. Its IUPAC name is 2-[5-(4-chlorophenyl)-2-methylphenyl]-5-[(5-methyl-1,3-dioxan-2-yl)methyl]cyclohexane-1,3-dione.
| Compound Name | 2-[5-(4-chlorophenyl)-2-methylphenyl]-5-[(5-methyl-1,3-dioxan-2-yl)methyl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 90714896 |
| Molecular Formula | C25H27ClO4 |
| Molecular Weight | 426.94 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 2-[5-(4-chlorophenyl)-2-methylphenyl]-5-[(5-methyl-1,3-dioxan-2-yl)methyl]cyclohexane-1,3-dione |
| SMILES | Cc1ccc(-c2ccc(Cl)cc2)cc1C1C(=O)CC(CC2OCC(C)CO2)CC1=O |
| InChI | InChI=1S/C25H27ClO4/c1-15-13-29-24(30-14-15)11-17-9-22(27)25(23(28)10-17)21-12-19(4-3-16(21)2)18-5-7-20(26)8-6-18/h3-8,12,15,17,24-25H,9-11,13-14H2,1-2H3 |
| InChIKey | MOOSTFFKHDSLLO-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.94 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|