C24H31N3OS — CID 90714969
ethylidene-[2-methyl-4-[(7-methylazepan-4-yl)methyl]benzimidazol-1-yl]-oxo-phenyl-λ6-sulfane (PubChem CID 90714969) has the molecular formula C24H31N3OS and a molecular weight of 409.60 g/mol. Its IUPAC name is ethylidene-[2-methyl-4-[(7-methylazepan-4-yl)methyl]benzimidazol-1-yl]-oxo-phenyl-λ6-sulfane.
| Compound Name | ethylidene-[2-methyl-4-[(7-methylazepan-4-yl)methyl]benzimidazol-1-yl]-oxo-phenyl-λ6-sulfane |
|---|---|
| PubChem CID | 90714969 |
| Molecular Formula | C24H31N3OS |
| Molecular Weight | 409.60 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | ethylidene-[2-methyl-4-[(7-methylazepan-4-yl)methyl]benzimidazol-1-yl]-oxo-phenyl-λ6-sulfane |
| SMILES | CC=S(=O)(c1ccccc1)n1c(C)nc2c(CC3CCNC(C)CC3)cccc21 |
| InChI | InChI=1S/C24H31N3OS/c1-4-29(28,22-10-6-5-7-11-22)27-19(3)26-24-21(9-8-12-23(24)27)17-20-14-13-18(2)25-16-15-20/h4-12,18,20,25H,13-17H2,1-3H3 |
| InChIKey | NUANMPRTQTZJAJ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.60 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|