About N'-(N'-ethenyl-N,N-dimethylcarbamimidoyl)-N,N-dimethylethanimidamide
N'-(N'-ethenyl-N,N-dimethylcarbamimidoyl)-N,N-dimethylethanimidamide (PubChem CID 90714976) has the molecular formula C9H18N4
and a molecular weight of 182.27 g/mol. Its IUPAC name is N'-(N'-ethenyl-N,N-dimethylcarbamimidoyl)-N,N-dimethylethanimidamide.
Molecular Properties
| Compound Name | N'-(N'-ethenyl-N,N-dimethylcarbamimidoyl)-N,N-dimethylethanimidamide |
| PubChem CID | 90714976 |
| Molecular Formula | C9H18N4 |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | N'-(N'-ethenyl-N,N-dimethylcarbamimidoyl)-N,N-dimethylethanimidamide |
| SMILES | C=C/N=C(/N=C(C)N(C)C)N(C)C |
| InChI | InChI=1S/C9H18N4/c1-7-10-9(13(5)6)11-8(2)12(3)4/h7H,1H2,2-6H3/b10-9-,11-8? |
| InChIKey | MZXGWRDMUSWKKQ-LRYJFLPDSA-N |
| XLogP | 1.03 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(N'-ethenyl-N,N-dimethylcarbamimidoyl)-N,N-dimethylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(N'-ethenyl-N,N-dimethylcarbamimidoyl)-N,N-dimethylethanimidamide?
The IUPAC name of N'-(N'-ethenyl-N,N-dimethylcarbamimidoyl)-N,N-dimethylethanimidamide (CID 90714976) is N'-(N'-ethenyl-N,N-dimethylcarbamimidoyl)-N,N-dimethylethanimidamide.
What is the SMILES notation for N'-(N'-ethenyl-N,N-dimethylcarbamimidoyl)-N,N-dimethylethanimidamide?
The canonical SMILES for N'-(N'-ethenyl-N,N-dimethylcarbamimidoyl)-N,N-dimethylethanimidamide is C=C/N=C(/N=C(C)N(C)C)N(C)C.
What is the InChIKey of N'-(N'-ethenyl-N,N-dimethylcarbamimidoyl)-N,N-dimethylethanimidamide?
The InChIKey is MZXGWRDMUSWKKQ-LRYJFLPDSA-N. The full InChI is InChI=1S/C9H18N4/c1-7-10-9(13(5)6)11-8(2)12(3)4/h7H,1H2,2-6H3/b10-9-,11-8?.
What are the key properties of N'-(N'-ethenyl-N,N-dimethylcarbamimidoyl)-N,N-dimethylethanimidamide?
N'-(N'-ethenyl-N,N-dimethylcarbamimidoyl)-N,N-dimethylethanimidamide has a molecular weight of 182.27 g/mol, XLogP of 1.03, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(N'-ethenyl-N,N-dimethylcarbamimidoyl)-N,N-dimethylethanimidamide is sourced from PubChem (CID 90714976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).