C35H42F6O5SSi — CID 90715043
[(2S,3S)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylpent-4-enyl] 4-methylbenzenesulfonate (PubChem CID 90715043) has the molecular formula C35H42F6O5SSi and a molecular weight of 716.86 g/mol. Its IUPAC name is [(2S,3S)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylpent-4-enyl] 4-methylbenzenesulfonate.
| Compound Name | [(2S,3S)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylpent-4-enyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 90715043 |
| Molecular Formula | C35H42F6O5SSi |
| Molecular Weight | 716.86 g/mol |
| Exact Mass | 716.24 |
| IUPAC Name | [(2S,3S)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylpent-4-enyl] 4-methylbenzenesulfonate |
| SMILES | C=C(CO[Si](C)(C)C(C)(C)C)C(c1ccccc1)[C@@H](COS(=O)(=O)c1ccc(C)cc1)O[C@H](C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C35H42F6O5SSi/c1-23-14-16-30(17-15-23)47(42,43)44-22-31(46-25(3)27-18-28(34(36,37)38)20-29(19-27)35(39,40)41)32(26-12-10-9-11-13-26)24(2)21-45-48(7,8)33(4,5)6/h9-20,25,31-32H,2,21-22H2,1,3-8H3/t25-,31-,32?/m1/s1 |
| InChIKey | JYAKCOQMMZNGQI-QAXYWWEJSA-N |
| XLogP | 10.25 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.86 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|