About 2-(7-bromo-3,3,6-trimethyl-4H-isoquinolin-1-yl)-1-cyclohexylethanone
2-(7-bromo-3,3,6-trimethyl-4H-isoquinolin-1-yl)-1-cyclohexylethanone (PubChem CID 90715050) has the molecular formula C20H26BrNO
and a molecular weight of 376.34 g/mol. Its IUPAC name is 2-(7-bromo-3,3,6-trimethyl-4H-isoquinolin-1-yl)-1-cyclohexylethanone.
Molecular Properties
| Compound Name | 2-(7-bromo-3,3,6-trimethyl-4H-isoquinolin-1-yl)-1-cyclohexylethanone |
| PubChem CID | 90715050 |
| Molecular Formula | C20H26BrNO |
| Molecular Weight | 376.34 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 2-(7-bromo-3,3,6-trimethyl-4H-isoquinolin-1-yl)-1-cyclohexylethanone |
| SMILES | Cc1cc2c(cc1Br)C(CC(=O)C1CCCCC1)=NC(C)(C)C2 |
| InChI | InChI=1S/C20H26BrNO/c1-13-9-15-12-20(2,3)22-18(16(15)10-17(13)21)11-19(23)14-7-5-4-6-8-14/h9-10,14H,4-8,11-12H2,1-3H3 |
| InChIKey | UWTXYJDWPLWZSA-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.34 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(7-bromo-3,3,6-trimethyl-4H-isoquinolin-1-yl)-1-cyclohexylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7-bromo-3,3,6-trimethyl-4H-isoquinolin-1-yl)-1-cyclohexylethanone?
The IUPAC name of 2-(7-bromo-3,3,6-trimethyl-4H-isoquinolin-1-yl)-1-cyclohexylethanone (CID 90715050) is 2-(7-bromo-3,3,6-trimethyl-4H-isoquinolin-1-yl)-1-cyclohexylethanone.
What is the SMILES notation for 2-(7-bromo-3,3,6-trimethyl-4H-isoquinolin-1-yl)-1-cyclohexylethanone?
The canonical SMILES for 2-(7-bromo-3,3,6-trimethyl-4H-isoquinolin-1-yl)-1-cyclohexylethanone is Cc1cc2c(cc1Br)C(CC(=O)C1CCCCC1)=NC(C)(C)C2.
What is the InChIKey of 2-(7-bromo-3,3,6-trimethyl-4H-isoquinolin-1-yl)-1-cyclohexylethanone?
The InChIKey is UWTXYJDWPLWZSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26BrNO/c1-13-9-15-12-20(2,3)22-18(16(15)10-17(13)21)11-19(23)14-7-5-4-6-8-14/h9-10,14H,4-8,11-12H2,1-3H3.
What are the key properties of 2-(7-bromo-3,3,6-trimethyl-4H-isoquinolin-1-yl)-1-cyclohexylethanone?
2-(7-bromo-3,3,6-trimethyl-4H-isoquinolin-1-yl)-1-cyclohexylethanone has a molecular weight of 376.34 g/mol, XLogP of 5.42, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-bromo-3,3,6-trimethyl-4H-isoquinolin-1-yl)-1-cyclohexylethanone is sourced from PubChem (CID 90715050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).