About 4-pyridin-3-yl-2,3-dihydro-1,4-benzoxazine
4-pyridin-3-yl-2,3-dihydro-1,4-benzoxazine (PubChem CID 90715593) has the molecular formula C13H12N2O
and a molecular weight of 212.25 g/mol. Its IUPAC name is 4-pyridin-3-yl-2,3-dihydro-1,4-benzoxazine.
Molecular Properties
| Compound Name | 4-pyridin-3-yl-2,3-dihydro-1,4-benzoxazine |
| PubChem CID | 90715593 |
| Molecular Formula | C13H12N2O |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 4-pyridin-3-yl-2,3-dihydro-1,4-benzoxazine |
| SMILES | c1cncc(N2CCOc3ccccc32)c1 |
| InChI | InChI=1S/C13H12N2O/c1-2-6-13-12(5-1)15(8-9-16-13)11-4-3-7-14-10-11/h1-7,10H,8-9H2 |
| InChIKey | ZBYJZPZMDHNWMW-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-pyridin-3-yl-2,3-dihydro-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pyridin-3-yl-2,3-dihydro-1,4-benzoxazine?
The IUPAC name of 4-pyridin-3-yl-2,3-dihydro-1,4-benzoxazine (CID 90715593) is 4-pyridin-3-yl-2,3-dihydro-1,4-benzoxazine.
What is the SMILES notation for 4-pyridin-3-yl-2,3-dihydro-1,4-benzoxazine?
The canonical SMILES for 4-pyridin-3-yl-2,3-dihydro-1,4-benzoxazine is c1cncc(N2CCOc3ccccc32)c1.
What is the InChIKey of 4-pyridin-3-yl-2,3-dihydro-1,4-benzoxazine?
The InChIKey is ZBYJZPZMDHNWMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O/c1-2-6-13-12(5-1)15(8-9-16-13)11-4-3-7-14-10-11/h1-7,10H,8-9H2.
What are the key properties of 4-pyridin-3-yl-2,3-dihydro-1,4-benzoxazine?
4-pyridin-3-yl-2,3-dihydro-1,4-benzoxazine has a molecular weight of 212.25 g/mol, XLogP of 2.61, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pyridin-3-yl-2,3-dihydro-1,4-benzoxazine is sourced from PubChem (CID 90715593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).