C20H14Cl2O5 — CID 90715712
2',7'-dichloro-3',6'-dihydroxyspiro[3a,6,7,7a-tetrahydro-2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 90715712) has the molecular formula C20H14Cl2O5 and a molecular weight of 405.23 g/mol. Its IUPAC name is 2',7'-dichloro-3',6'-dihydroxyspiro[3a,6,7,7a-tetrahydro-2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 2',7'-dichloro-3',6'-dihydroxyspiro[3a,6,7,7a-tetrahydro-2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 90715712 |
| Molecular Formula | C20H14Cl2O5 |
| Molecular Weight | 405.23 g/mol |
| Exact Mass | 404.02 |
| IUPAC Name | 2',7'-dichloro-3',6'-dihydroxyspiro[3a,6,7,7a-tetrahydro-2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | O=C1OC2(c3cc(Cl)c(O)cc3Oc3cc(O)c(Cl)cc32)C2C=CCCC12 |
| InChI | InChI=1S/C20H14Cl2O5/c21-13-5-11-17(7-15(13)23)26-18-8-16(24)14(22)6-12(18)20(11)10-4-2-1-3-9(10)19(25)27-20/h2,4-10,23-24H,1,3H2 |
| InChIKey | VCWDPAFNPWWXAD-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.23 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|