About 4-iminocyclohexa-1,5-diene-1-carbonitrile
4-iminocyclohexa-1,5-diene-1-carbonitrile (PubChem CID 90715894) has the molecular formula C7H6N2
and a molecular weight of 118.14 g/mol. Its IUPAC name is 4-iminocyclohexa-1,5-diene-1-carbonitrile.
Molecular Properties
| Compound Name | 4-iminocyclohexa-1,5-diene-1-carbonitrile |
| PubChem CID | 90715894 |
| Molecular Formula | C7H6N2 |
| Molecular Weight | 118.14 g/mol |
| Exact Mass | 118.05 |
| IUPAC Name | 4-iminocyclohexa-1,5-diene-1-carbonitrile |
| SMILES | [H]/N=C1/C=CC(C#N)=CC1 |
| InChI | InChI=1S/C7H6N2/c8-5-6-1-3-7(9)4-2-6/h1-3,9H,4H2/b9-7- |
| InChIKey | AMVMLGMCINXJFF-CLFYSBASSA-N |
| XLogP | 1.42 |
| TPSA | 47.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.14 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-iminocyclohexa-1,5-diene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-iminocyclohexa-1,5-diene-1-carbonitrile?
The IUPAC name of 4-iminocyclohexa-1,5-diene-1-carbonitrile (CID 90715894) is 4-iminocyclohexa-1,5-diene-1-carbonitrile.
What is the SMILES notation for 4-iminocyclohexa-1,5-diene-1-carbonitrile?
The canonical SMILES for 4-iminocyclohexa-1,5-diene-1-carbonitrile is [H]/N=C1/C=CC(C#N)=CC1.
What is the InChIKey of 4-iminocyclohexa-1,5-diene-1-carbonitrile?
The InChIKey is AMVMLGMCINXJFF-CLFYSBASSA-N. The full InChI is InChI=1S/C7H6N2/c8-5-6-1-3-7(9)4-2-6/h1-3,9H,4H2/b9-7-.
What are the key properties of 4-iminocyclohexa-1,5-diene-1-carbonitrile?
4-iminocyclohexa-1,5-diene-1-carbonitrile has a molecular weight of 118.14 g/mol, XLogP of 1.42, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-iminocyclohexa-1,5-diene-1-carbonitrile is sourced from PubChem (CID 90715894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).