C16H8BF10N — CID 90716556
bis(2,3,4,5,6-pentafluorophenyl)-pyrrolidin-1-ylborane (PubChem CID 90716556) has the molecular formula C16H8BF10N and a molecular weight of 415.04 g/mol. Its IUPAC name is bis(2,3,4,5,6-pentafluorophenyl)-pyrrolidin-1-ylborane.
| Compound Name | bis(2,3,4,5,6-pentafluorophenyl)-pyrrolidin-1-ylborane |
|---|---|
| PubChem CID | 90716556 |
| Molecular Formula | C16H8BF10N |
| Molecular Weight | 415.04 g/mol |
| Exact Mass | 415.06 |
| IUPAC Name | bis(2,3,4,5,6-pentafluorophenyl)-pyrrolidin-1-ylborane |
| SMILES | Fc1c(F)c(F)c(B(c2c(F)c(F)c(F)c(F)c2F)N2CCCC2)c(F)c1F |
| InChI | InChI=1S/C16H8BF10N/c18-7-5(8(19)12(23)15(26)11(7)22)17(28-3-1-2-4-28)6-9(20)13(24)16(27)14(25)10(6)21/h1-4H2 |
| InChIKey | NAWUZTVFVAUAAV-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.04 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|