About 1-methyl-3-[(Z)-[(2S,5S)-5-methyl-2-propan-2-ylcyclohexylidene]amino]thiourea
1-methyl-3-[(Z)-[(2S,5S)-5-methyl-2-propan-2-ylcyclohexylidene]amino]thiourea (PubChem CID 9071727) has the molecular formula C12H23N3S
and a molecular weight of 241.40 g/mol. Its IUPAC name is 1-methyl-3-[(Z)-[(2S,5S)-5-methyl-2-propan-2-ylcyclohexylidene]amino]thiourea.
Molecular Properties
| Compound Name | 1-methyl-3-[(Z)-[(2S,5S)-5-methyl-2-propan-2-ylcyclohexylidene]amino]thiourea |
| PubChem CID | 9071727 |
| Molecular Formula | C12H23N3S |
| Molecular Weight | 241.40 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 1-methyl-3-[(Z)-[(2S,5S)-5-methyl-2-propan-2-ylcyclohexylidene]amino]thiourea |
| SMILES | CNC(=S)N/N=C1/C[C@@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C12H23N3S/c1-8(2)10-6-5-9(3)7-11(10)14-15-12(16)13-4/h8-10H,5-7H2,1-4H3,(H2,13,15,16)/b14-11-/t9-,10-/m0/s1 |
| InChIKey | MMINZUOKGPKHSB-CRLTZBKTSA-N |
| XLogP | 2.53 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.40 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-3-[(Z)-[(2S,5S)-5-methyl-2-propan-2-ylcyclohexylidene]amino]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-[(Z)-[(2S,5S)-5-methyl-2-propan-2-ylcyclohexylidene]amino]thiourea?
The IUPAC name of 1-methyl-3-[(Z)-[(2S,5S)-5-methyl-2-propan-2-ylcyclohexylidene]amino]thiourea (CID 9071727) is 1-methyl-3-[(Z)-[(2S,5S)-5-methyl-2-propan-2-ylcyclohexylidene]amino]thiourea.
What is the SMILES notation for 1-methyl-3-[(Z)-[(2S,5S)-5-methyl-2-propan-2-ylcyclohexylidene]amino]thiourea?
The canonical SMILES for 1-methyl-3-[(Z)-[(2S,5S)-5-methyl-2-propan-2-ylcyclohexylidene]amino]thiourea is CNC(=S)N/N=C1/C[C@@H](C)CC[C@H]1C(C)C.
What is the InChIKey of 1-methyl-3-[(Z)-[(2S,5S)-5-methyl-2-propan-2-ylcyclohexylidene]amino]thiourea?
The InChIKey is MMINZUOKGPKHSB-CRLTZBKTSA-N. The full InChI is InChI=1S/C12H23N3S/c1-8(2)10-6-5-9(3)7-11(10)14-15-12(16)13-4/h8-10H,5-7H2,1-4H3,(H2,13,15,16)/b14-11-/t9-,10-/m0/s1.
What are the key properties of 1-methyl-3-[(Z)-[(2S,5S)-5-methyl-2-propan-2-ylcyclohexylidene]amino]thiourea?
1-methyl-3-[(Z)-[(2S,5S)-5-methyl-2-propan-2-ylcyclohexylidene]amino]thiourea has a molecular weight of 241.40 g/mol, XLogP of 2.53, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-[(Z)-[(2S,5S)-5-methyl-2-propan-2-ylcyclohexylidene]amino]thiourea is sourced from PubChem (CID 9071727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).