C23H32N4O3 — CID 90717499
1-[3-[amino(phenyl)methylidene]oxan-4-ylidene]-3-(3,3-dimethyl-1-oxo-1-pyrrolidin-1-ylbutan-2-yl)urea (PubChem CID 90717499) has the molecular formula C23H32N4O3 and a molecular weight of 412.53 g/mol. Its IUPAC name is 1-[3-[amino(phenyl)methylidene]oxan-4-ylidene]-3-(3,3-dimethyl-1-oxo-1-pyrrolidin-1-ylbutan-2-yl)urea.
| Compound Name | 1-[3-[amino(phenyl)methylidene]oxan-4-ylidene]-3-(3,3-dimethyl-1-oxo-1-pyrrolidin-1-ylbutan-2-yl)urea |
|---|---|
| PubChem CID | 90717499 |
| Molecular Formula | C23H32N4O3 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | 1-[3-[amino(phenyl)methylidene]oxan-4-ylidene]-3-(3,3-dimethyl-1-oxo-1-pyrrolidin-1-ylbutan-2-yl)urea |
| SMILES | CC(C)(C)C(NC(=O)N=C1CCOCC1=C(N)c1ccccc1)C(=O)N1CCCC1 |
| InChI | InChI=1S/C23H32N4O3/c1-23(2,3)20(21(28)27-12-7-8-13-27)26-22(29)25-18-11-14-30-15-17(18)19(24)16-9-5-4-6-10-16/h4-6,9-10,20H,7-8,11-15,24H2,1-3H3,(H,26,29) |
| InChIKey | CHRWPZYVWYGHJO-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|