C22H22FN3O2 — CID 90717514
1-(3H-benzimidazol-5-yl)-5-(3-fluorophenyl)-4-pentylpyrrole-2,3-diol (PubChem CID 90717514) has the molecular formula C22H22FN3O2 and a molecular weight of 379.44 g/mol. Its IUPAC name is 1-(3H-benzimidazol-5-yl)-5-(3-fluorophenyl)-4-pentylpyrrole-2,3-diol.
| Compound Name | 1-(3H-benzimidazol-5-yl)-5-(3-fluorophenyl)-4-pentylpyrrole-2,3-diol |
|---|---|
| PubChem CID | 90717514 |
| Molecular Formula | C22H22FN3O2 |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 1-(3H-benzimidazol-5-yl)-5-(3-fluorophenyl)-4-pentylpyrrole-2,3-diol |
| SMILES | CCCCCc1c(O)c(O)n(-c2ccc3nc[nH]c3c2)c1-c1cccc(F)c1 |
| InChI | InChI=1S/C22H22FN3O2/c1-2-3-4-8-17-20(14-6-5-7-15(23)11-14)26(22(28)21(17)27)16-9-10-18-19(12-16)25-13-24-18/h5-7,9-13,27-28H,2-4,8H2,1H3,(H,24,25) |
| InChIKey | DHXPBHLYONAESG-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 74.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|