C26H19FN2O2 — CID 90717516
7-[(4-fluorophenyl)methyl]-5-(2-phenylethenyl)pyrrolo[3,4-g]quinoline-8,9-diol (PubChem CID 90717516) has the molecular formula C26H19FN2O2 and a molecular weight of 410.45 g/mol. Its IUPAC name is 7-[(4-fluorophenyl)methyl]-5-(2-phenylethenyl)pyrrolo[3,4-g]quinoline-8,9-diol.
| Compound Name | 7-[(4-fluorophenyl)methyl]-5-(2-phenylethenyl)pyrrolo[3,4-g]quinoline-8,9-diol |
|---|---|
| PubChem CID | 90717516 |
| Molecular Formula | C26H19FN2O2 |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 7-[(4-fluorophenyl)methyl]-5-(2-phenylethenyl)pyrrolo[3,4-g]quinoline-8,9-diol |
| SMILES | Oc1c2ncccc2c(C=Cc2ccccc2)c2cn(Cc3ccc(F)cc3)c(O)c12 |
| InChI | InChI=1S/C26H19FN2O2/c27-19-11-8-18(9-12-19)15-29-16-22-20(13-10-17-5-2-1-3-6-17)21-7-4-14-28-24(21)25(30)23(22)26(29)31/h1-14,16,30-31H,15H2 |
| InChIKey | VUWJJCIPRKJPDR-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|