C38H34F4O4S2 — CID 90717670
bis(5,5-difluoro-2,3-dimethylcyclopenta[b]thiophene-4,6-dione);ethane;pyrene (PubChem CID 90717670) has the molecular formula C38H34F4O4S2 and a molecular weight of 694.81 g/mol. Its IUPAC name is bis(5,5-difluoro-2,3-dimethylcyclopenta[b]thiophene-4,6-dione);ethane;pyrene.
| Compound Name | bis(5,5-difluoro-2,3-dimethylcyclopenta[b]thiophene-4,6-dione);ethane;pyrene |
|---|---|
| PubChem CID | 90717670 |
| Molecular Formula | C38H34F4O4S2 |
| Molecular Weight | 694.81 g/mol |
| Exact Mass | 694.18 |
| IUPAC Name | bis(5,5-difluoro-2,3-dimethylcyclopenta[b]thiophene-4,6-dione);ethane;pyrene |
| SMILES | CC.CC.Cc1sc2c(c1C)C(=O)C(F)(F)C2=O.Cc1sc2c(c1C)C(=O)C(F)(F)C2=O.c1cc2ccc3cccc4ccc(c1)c2c34 |
| InChI | InChI=1S/C16H10.2C9H6F2O2S.2C2H6/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14;2*1-3-4(2)14-6-5(3)7(12)9(10,11)8(6)13;2*1-2/h1-10H;2*1-2H3;2*1-2H3 |
| InChIKey | NCQODFBDVXKATB-UHFFFAOYSA-N |
| XLogP | 11.39 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.81 |
| LogP ≤ 5 | 11.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|