C15H24O — CID 90717815
3-methyl-2-(6-methylocta-5,7-dien-4-yl)cyclopentan-1-one (PubChem CID 90717815) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is 3-methyl-2-(6-methylocta-5,7-dien-4-yl)cyclopentan-1-one.
| Compound Name | 3-methyl-2-(6-methylocta-5,7-dien-4-yl)cyclopentan-1-one |
|---|---|
| PubChem CID | 90717815 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | 3-methyl-2-(6-methylocta-5,7-dien-4-yl)cyclopentan-1-one |
| SMILES | C=CC(C)=CC(CCC)C1C(=O)CCC1C |
| InChI | InChI=1S/C15H24O/c1-5-7-13(10-11(3)6-2)15-12(4)8-9-14(15)16/h6,10,12-13,15H,2,5,7-9H2,1,3-4H3 |
| InChIKey | WRYOISSKFFAIIE-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|