C16H15N3O2 — CID 90717860
N-[(1S,2R,4R)-7-azabicyclo[2.2.1]heptan-2-yl]-2-ethynylfuro[3,2-c]pyridine-6-carboxamide (PubChem CID 90717860) has the molecular formula C16H15N3O2 and a molecular weight of 281.31 g/mol. Its IUPAC name is N-[(1S,2R,4R)-7-azabicyclo[2.2.1]heptan-2-yl]-2-ethynylfuro[3,2-c]pyridine-6-carboxamide.
| Compound Name | N-[(1S,2R,4R)-7-azabicyclo[2.2.1]heptan-2-yl]-2-ethynylfuro[3,2-c]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 90717860 |
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | N-[(1S,2R,4R)-7-azabicyclo[2.2.1]heptan-2-yl]-2-ethynylfuro[3,2-c]pyridine-6-carboxamide |
| SMILES | C#Cc1cc2cnc(C(=O)N[C@@H]3C[C@H]4CC[C@@H]3N4)cc2o1 |
| InChI | InChI=1S/C16H15N3O2/c1-2-11-5-9-8-17-14(7-15(9)21-11)16(20)19-13-6-10-3-4-12(13)18-10/h1,5,7-8,10,12-13,18H,3-4,6H2,(H,19,20)/t10-,12+,13-/m1/s1 |
| InChIKey | CNIABSYAVGJONM-KGYLQXTDSA-N |
| XLogP | 1.43 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|