C26H32O8 — CID 90718068
(5S,9R,13R,14S)-10-hydroxy-18-(methoxymethoxy)-7,7,13,14-tetramethyl-6,8,15,21-tetraoxatetracyclo[15.7.0.05,9.020,24]tetracosa-1(24),2,11,17,19,22-hexaen-16-one (PubChem CID 90718068) has the molecular formula C26H32O8 and a molecular weight of 472.53 g/mol. Its IUPAC name is (5S,9R,13R,14S)-10-hydroxy-18-(methoxymethoxy)-7,7,13,14-tetramethyl-6,8,15,21-tetraoxatetracyclo[15.7.0.05,9.020,24]tetracosa-1(24),2,11,17,19,22-hexaen-16-one.
| Compound Name | (5S,9R,13R,14S)-10-hydroxy-18-(methoxymethoxy)-7,7,13,14-tetramethyl-6,8,15,21-tetraoxatetracyclo[15.7.0.05,9.020,24]tetracosa-1(24),2,11,17,19,22-hexaen-16-one |
|---|---|
| PubChem CID | 90718068 |
| Molecular Formula | C26H32O8 |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | (5S,9R,13R,14S)-10-hydroxy-18-(methoxymethoxy)-7,7,13,14-tetramethyl-6,8,15,21-tetraoxatetracyclo[15.7.0.05,9.020,24]tetracosa-1(24),2,11,17,19,22-hexaen-16-one |
| SMILES | COCOc1cc2occc2c2c1C(=O)O[C@@H](C)[C@H](C)C=CC(O)[C@H]1OC(C)(C)O[C@H]1CC=C2 |
| InChI | InChI=1S/C26H32O8/c1-15-9-10-19(27)24-20(33-26(3,4)34-24)8-6-7-18-17-11-12-30-21(17)13-22(31-14-29-5)23(18)25(28)32-16(15)2/h6-7,9-13,15-16,19-20,24,27H,8,14H2,1-5H3/t15-,16+,19?,20+,24-/m1/s1 |
| InChIKey | DEUZAEGMVSIZHK-RWLCWYBNSA-N |
| XLogP | 4.45 |
| TPSA | 96.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|