C31H40FN3O5SSi — CID 90718143
2-[3-[(4-fluorophenyl)methyl]-8-hydroxy-7-methyl-9-tri(propan-2-yl)silyloxypyrrolo[3,4-g]quinolin-5-yl]-N-methylsulfonylacetamide (PubChem CID 90718143) has the molecular formula C31H40FN3O5SSi and a molecular weight of 613.83 g/mol. Its IUPAC name is 2-[3-[(4-fluorophenyl)methyl]-8-hydroxy-7-methyl-9-tri(propan-2-yl)silyloxypyrrolo[3,4-g]quinolin-5-yl]-N-methylsulfonylacetamide.
| Compound Name | 2-[3-[(4-fluorophenyl)methyl]-8-hydroxy-7-methyl-9-tri(propan-2-yl)silyloxypyrrolo[3,4-g]quinolin-5-yl]-N-methylsulfonylacetamide |
|---|---|
| PubChem CID | 90718143 |
| Molecular Formula | C31H40FN3O5SSi |
| Molecular Weight | 613.83 g/mol |
| Exact Mass | 613.24 |
| IUPAC Name | 2-[3-[(4-fluorophenyl)methyl]-8-hydroxy-7-methyl-9-tri(propan-2-yl)silyloxypyrrolo[3,4-g]quinolin-5-yl]-N-methylsulfonylacetamide |
| SMILES | CC(C)[Si](Oc1c2ncc(Cc3ccc(F)cc3)cc2c(CC(=O)NS(C)(=O)=O)c2cn(C)c(O)c12)(C(C)C)C(C)C |
| InChI | InChI=1S/C31H40FN3O5SSi/c1-18(2)42(19(3)4,20(5)6)40-30-28-26(17-35(7)31(28)37)24(15-27(36)34-41(8,38)39)25-14-22(16-33-29(25)30)13-21-9-11-23(32)12-10-21/h9-12,14,16-20,37H,13,15H2,1-8H3,(H,34,36) |
| InChIKey | HEMSMZSKWJTJRS-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.83 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|