C23H24N2O6 — CID 90718192
(E)-1-(3,4-dimethoxyphenyl)-3-[3-(3,4,5-trimethoxyphenyl)-1H-pyrazol-5-yl]prop-2-en-1-one (PubChem CID 90718192) has the molecular formula C23H24N2O6 and a molecular weight of 424.45 g/mol. Its IUPAC name is (E)-1-(3,4-dimethoxyphenyl)-3-[3-(3,4,5-trimethoxyphenyl)-1H-pyrazol-5-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(3,4-dimethoxyphenyl)-3-[3-(3,4,5-trimethoxyphenyl)-1H-pyrazol-5-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 90718192 |
| Molecular Formula | C23H24N2O6 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | (E)-1-(3,4-dimethoxyphenyl)-3-[3-(3,4,5-trimethoxyphenyl)-1H-pyrazol-5-yl]prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C=C/c2cc(-c3cc(OC)c(OC)c(OC)c3)n[nH]2)cc1OC |
| InChI | InChI=1S/C23H24N2O6/c1-27-19-9-6-14(10-20(19)28-2)18(26)8-7-16-13-17(25-24-16)15-11-21(29-3)23(31-5)22(12-15)30-4/h6-13H,1-5H3,(H,24,25)/b8-7+ |
| InChIKey | AEKHVVUIZHWELD-BQYQJAHWSA-N |
| XLogP | 4.02 |
| TPSA | 91.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|