C19H17F3N4O3 — CID 90718222
8-[4-[4-(trifluoromethoxy)phenyl]-2-pyridinyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 90718222) has the molecular formula C19H17F3N4O3 and a molecular weight of 406.36 g/mol. Its IUPAC name is 8-[4-[4-(trifluoromethoxy)phenyl]-2-pyridinyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-[4-[4-(trifluoromethoxy)phenyl]-2-pyridinyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 90718222 |
| Molecular Formula | C19H17F3N4O3 |
| Molecular Weight | 406.36 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 8-[4-[4-(trifluoromethoxy)phenyl]-2-pyridinyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C1NC(=O)C2(CCN(c3cc(-c4ccc(OC(F)(F)F)cc4)ccn3)CC2)N1 |
| InChI | InChI=1S/C19H17F3N4O3/c20-19(21,22)29-14-3-1-12(2-4-14)13-5-8-23-15(11-13)26-9-6-18(7-10-26)16(27)24-17(28)25-18/h1-5,8,11H,6-7,9-10H2,(H2,24,25,27,28) |
| InChIKey | DHFKCPVBZMHYQG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|