C19H20N2O4S — CID 9071839
(3S)-1-(4-methylphenyl)-N-(3-methylsulfonylphenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 9071839) has the molecular formula C19H20N2O4S and a molecular weight of 372.45 g/mol. Its IUPAC name is (3S)-1-(4-methylphenyl)-N-(3-methylsulfonylphenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-(4-methylphenyl)-N-(3-methylsulfonylphenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 9071839 |
| Molecular Formula | C19H20N2O4S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | (3S)-1-(4-methylphenyl)-N-(3-methylsulfonylphenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | Cc1ccc(N2C[C@@H](C(=O)Nc3cccc(S(C)(=O)=O)c3)CC2=O)cc1 |
| InChI | InChI=1S/C19H20N2O4S/c1-13-6-8-16(9-7-13)21-12-14(10-18(21)22)19(23)20-15-4-3-5-17(11-15)26(2,24)25/h3-9,11,14H,10,12H2,1-2H3,(H,20,23)/t14-/m0/s1 |
| InChIKey | AOXNYOBFULVOJL-AWEZNQCLSA-N |
| XLogP | 2.39 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |