About 7-amino-2-(3,3,3-trifluoropropyl)isoindol-1-ol
7-amino-2-(3,3,3-trifluoropropyl)isoindol-1-ol (PubChem CID 90718591) has the molecular formula C11H11F3N2O
and a molecular weight of 244.22 g/mol. Its IUPAC name is 7-amino-2-(3,3,3-trifluoropropyl)isoindol-1-ol.
Molecular Properties
| Compound Name | 7-amino-2-(3,3,3-trifluoropropyl)isoindol-1-ol |
| PubChem CID | 90718591 |
| Molecular Formula | C11H11F3N2O |
| Molecular Weight | 244.22 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 7-amino-2-(3,3,3-trifluoropropyl)isoindol-1-ol |
| SMILES | Nc1cccc2cn(CCC(F)(F)F)c(O)c12 |
| InChI | InChI=1S/C11H11F3N2O/c12-11(13,14)4-5-16-6-7-2-1-3-8(15)9(7)10(16)17/h1-3,6,17H,4-5,15H2 |
| InChIKey | HZAHGFZFCDYHMB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.22 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 7-amino-2-(3,3,3-trifluoropropyl)isoindol-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-amino-2-(3,3,3-trifluoropropyl)isoindol-1-ol?
The IUPAC name of 7-amino-2-(3,3,3-trifluoropropyl)isoindol-1-ol (CID 90718591) is 7-amino-2-(3,3,3-trifluoropropyl)isoindol-1-ol.
What is the SMILES notation for 7-amino-2-(3,3,3-trifluoropropyl)isoindol-1-ol?
The canonical SMILES for 7-amino-2-(3,3,3-trifluoropropyl)isoindol-1-ol is Nc1cccc2cn(CCC(F)(F)F)c(O)c12.
What is the InChIKey of 7-amino-2-(3,3,3-trifluoropropyl)isoindol-1-ol?
The InChIKey is HZAHGFZFCDYHMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11F3N2O/c12-11(13,14)4-5-16-6-7-2-1-3-8(15)9(7)10(16)17/h1-3,6,17H,4-5,15H2.
What are the key properties of 7-amino-2-(3,3,3-trifluoropropyl)isoindol-1-ol?
7-amino-2-(3,3,3-trifluoropropyl)isoindol-1-ol has a molecular weight of 244.22 g/mol, XLogP of 2.88, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-2-(3,3,3-trifluoropropyl)isoindol-1-ol is sourced from PubChem (CID 90718591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).