C17H33F2NO5S2 — CID 90718718
4,4-difluoro-3,5-dimethyl-5-(2,2,6,6-tetramethylpiperidin-1-yl)sulfonylhexane-3-sulfonic acid (PubChem CID 90718718) has the molecular formula C17H33F2NO5S2 and a molecular weight of 433.58 g/mol. Its IUPAC name is 4,4-difluoro-3,5-dimethyl-5-(2,2,6,6-tetramethylpiperidin-1-yl)sulfonylhexane-3-sulfonic acid.
| Compound Name | 4,4-difluoro-3,5-dimethyl-5-(2,2,6,6-tetramethylpiperidin-1-yl)sulfonylhexane-3-sulfonic acid |
|---|---|
| PubChem CID | 90718718 |
| Molecular Formula | C17H33F2NO5S2 |
| Molecular Weight | 433.58 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 4,4-difluoro-3,5-dimethyl-5-(2,2,6,6-tetramethylpiperidin-1-yl)sulfonylhexane-3-sulfonic acid |
| SMILES | CCC(C)(C(F)(F)C(C)(C)S(=O)(=O)N1C(C)(C)CCCC1(C)C)S(=O)(=O)O |
| InChI | InChI=1S/C17H33F2NO5S2/c1-9-16(8,27(23,24)25)17(18,19)15(6,7)26(21,22)20-13(2,3)11-10-12-14(20,4)5/h9-12H2,1-8H3,(H,23,24,25) |
| InChIKey | ILZVRCVDNSEJQS-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.58 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|