About 4-(2,4-dichlorophenyl)-1-methylpyrrolidine-2,3,5-trione
4-(2,4-dichlorophenyl)-1-methylpyrrolidine-2,3,5-trione (PubChem CID 90718788) has the molecular formula C11H7Cl2NO3
and a molecular weight of 272.09 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-1-methylpyrrolidine-2,3,5-trione.
Molecular Properties
| Compound Name | 4-(2,4-dichlorophenyl)-1-methylpyrrolidine-2,3,5-trione |
| PubChem CID | 90718788 |
| Molecular Formula | C11H7Cl2NO3 |
| Molecular Weight | 272.09 g/mol |
| Exact Mass | 270.98 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-1-methylpyrrolidine-2,3,5-trione |
| SMILES | CN1C(=O)C(=O)C(c2ccc(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C11H7Cl2NO3/c1-14-10(16)8(9(15)11(14)17)6-3-2-5(12)4-7(6)13/h2-4,8H,1H3 |
| InChIKey | UYJYKXKTCSYXSK-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.09 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,4-dichlorophenyl)-1-methylpyrrolidine-2,3,5-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,4-dichlorophenyl)-1-methylpyrrolidine-2,3,5-trione?
The IUPAC name of 4-(2,4-dichlorophenyl)-1-methylpyrrolidine-2,3,5-trione (CID 90718788) is 4-(2,4-dichlorophenyl)-1-methylpyrrolidine-2,3,5-trione.
What is the SMILES notation for 4-(2,4-dichlorophenyl)-1-methylpyrrolidine-2,3,5-trione?
The canonical SMILES for 4-(2,4-dichlorophenyl)-1-methylpyrrolidine-2,3,5-trione is CN1C(=O)C(=O)C(c2ccc(Cl)cc2Cl)C1=O.
What is the InChIKey of 4-(2,4-dichlorophenyl)-1-methylpyrrolidine-2,3,5-trione?
The InChIKey is UYJYKXKTCSYXSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7Cl2NO3/c1-14-10(16)8(9(15)11(14)17)6-3-2-5(12)4-7(6)13/h2-4,8H,1H3.
What are the key properties of 4-(2,4-dichlorophenyl)-1-methylpyrrolidine-2,3,5-trione?
4-(2,4-dichlorophenyl)-1-methylpyrrolidine-2,3,5-trione has a molecular weight of 272.09 g/mol, XLogP of 1.64, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4-dichlorophenyl)-1-methylpyrrolidine-2,3,5-trione is sourced from PubChem (CID 90718788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).