About 5-chloro-N,4-dimethylpyrimidin-2-amine
5-chloro-N,4-dimethylpyrimidin-2-amine (PubChem CID 90718950) has the molecular formula C6H8ClN3
and a molecular weight of 157.60 g/mol. Its IUPAC name is 5-chloro-N,4-dimethylpyrimidin-2-amine.
Molecular Properties
| Compound Name | 5-chloro-N,4-dimethylpyrimidin-2-amine |
| PubChem CID | 90718950 |
| Molecular Formula | C6H8ClN3 |
| Molecular Weight | 157.60 g/mol |
| Exact Mass | 157.04 |
| IUPAC Name | 5-chloro-N,4-dimethylpyrimidin-2-amine |
| SMILES | CNc1ncc(Cl)c(C)n1 |
| InChI | InChI=1S/C6H8ClN3/c1-4-5(7)3-9-6(8-2)10-4/h3H,1-2H3,(H,8,9,10) |
| InChIKey | IHJUXMCYDQDJKW-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.60 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-chloro-N,4-dimethylpyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N,4-dimethylpyrimidin-2-amine?
The IUPAC name of 5-chloro-N,4-dimethylpyrimidin-2-amine (CID 90718950) is 5-chloro-N,4-dimethylpyrimidin-2-amine.
What is the SMILES notation for 5-chloro-N,4-dimethylpyrimidin-2-amine?
The canonical SMILES for 5-chloro-N,4-dimethylpyrimidin-2-amine is CNc1ncc(Cl)c(C)n1.
What is the InChIKey of 5-chloro-N,4-dimethylpyrimidin-2-amine?
The InChIKey is IHJUXMCYDQDJKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8ClN3/c1-4-5(7)3-9-6(8-2)10-4/h3H,1-2H3,(H,8,9,10).
What are the key properties of 5-chloro-N,4-dimethylpyrimidin-2-amine?
5-chloro-N,4-dimethylpyrimidin-2-amine has a molecular weight of 157.60 g/mol, XLogP of 1.48, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N,4-dimethylpyrimidin-2-amine is sourced from PubChem (CID 90718950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).